C13H24N2 — CID 143071579
N-(3,4-dimethylpent-4-enyl)-N-methyl-N'-[(Z)-prop-1-enyl]ethanimidamide (PubChem CID 143071579) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is N-(3,4-dimethylpent-4-enyl)-N-methyl-N'-[(Z)-prop-1-enyl]ethanimidamide.
| Compound Name | N-(3,4-dimethylpent-4-enyl)-N-methyl-N'-[(Z)-prop-1-enyl]ethanimidamide |
|---|---|
| PubChem CID | 143071579 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | N-(3,4-dimethylpent-4-enyl)-N-methyl-N'-[(Z)-prop-1-enyl]ethanimidamide |
| SMILES | C=C(C)C(C)CCN(C)/C(C)=N/C=C\C |
| InChI | InChI=1S/C13H24N2/c1-7-9-14-13(5)15(6)10-8-12(4)11(2)3/h7,9,12H,2,8,10H2,1,3-6H3/b9-7-,14-13+ |
| InChIKey | OBVVUYFBSHTFFZ-WJLPJGEKSA-N |
| XLogP | 3.47 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|