C14H28N2 — CID 144550349
ethane;1-ethenyl-N,5-dimethyl-3,4-dihydropyridin-2-imine;propane (PubChem CID 144550349) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is ethane;1-ethenyl-N,5-dimethyl-3,4-dihydropyridin-2-imine;propane.
| Compound Name | ethane;1-ethenyl-N,5-dimethyl-3,4-dihydropyridin-2-imine;propane |
|---|---|
| PubChem CID | 144550349 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | ethane;1-ethenyl-N,5-dimethyl-3,4-dihydropyridin-2-imine;propane |
| SMILES | C=CN1C=C(C)CC/C1=N\C.CC.CCC |
| InChI | InChI=1S/C9H14N2.C3H8.C2H6/c1-4-11-7-8(2)5-6-9(11)10-3;1-3-2;1-2/h4,7H,1,5-6H2,2-3H3;3H2,1-2H3;1-2H3/b10-9+;; |
| InChIKey | GDPFUTDZMHMTGP-TTWKNDKESA-N |
| XLogP | 4.60 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|