C14H25N3 — CID 142128682
ethane;4-methylidene-2-(4-methylpiperazin-1-yl)-3,5-dihydroazepine (PubChem CID 142128682) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is ethane;4-methylidene-2-(4-methylpiperazin-1-yl)-3,5-dihydroazepine.
| Compound Name | ethane;4-methylidene-2-(4-methylpiperazin-1-yl)-3,5-dihydroazepine |
|---|---|
| PubChem CID | 142128682 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | ethane;4-methylidene-2-(4-methylpiperazin-1-yl)-3,5-dihydroazepine |
| SMILES | C=C1CC=CN=C(N2CCN(C)CC2)C1.CC |
| InChI | InChI=1S/C12H19N3.C2H6/c1-11-4-3-5-13-12(10-11)15-8-6-14(2)7-9-15;1-2/h3,5H,1,4,6-10H2,2H3;1-2H3 |
| InChIKey | WPSDJMLQIBJXIM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|