C13H21N3 — CID 142128671
(6Z,8Z)-2-(4-methylpiperazin-1-yl)-4,5-dihydro-3H-azonine (PubChem CID 142128671) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is (6Z,8Z)-2-(4-methylpiperazin-1-yl)-4,5-dihydro-3H-azonine.
| Compound Name | (6Z,8Z)-2-(4-methylpiperazin-1-yl)-4,5-dihydro-3H-azonine |
|---|---|
| PubChem CID | 142128671 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | (6Z,8Z)-2-(4-methylpiperazin-1-yl)-4,5-dihydro-3H-azonine |
| SMILES | CN1CCN(/C2=N/C=C\C=C/CCC2)CC1 |
| InChI | InChI=1S/C13H21N3/c1-15-9-11-16(12-10-15)13-7-5-3-2-4-6-8-14-13/h2,4,6,8H,3,5,7,9-12H2,1H3/b4-2-,8-6-,14-13+ |
| InChIKey | LECJSZLDIPDVIH-RRSRALGNSA-N |
| XLogP | 1.89 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |