C12H19N3 — CID 142128683
4-methylidene-2-(4-methylpiperazin-1-yl)-3,5-dihydroazepine (PubChem CID 142128683) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is 4-methylidene-2-(4-methylpiperazin-1-yl)-3,5-dihydroazepine.
| Compound Name | 4-methylidene-2-(4-methylpiperazin-1-yl)-3,5-dihydroazepine |
|---|---|
| PubChem CID | 142128683 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 4-methylidene-2-(4-methylpiperazin-1-yl)-3,5-dihydroazepine |
| SMILES | C=C1CC=CN=C(N2CCN(C)CC2)C1 |
| InChI | InChI=1S/C12H19N3/c1-11-4-3-5-13-12(10-11)15-8-6-14(2)7-9-15/h3,5H,1,4,6-10H2,2H3 |
| InChIKey | NEPAJGVFUVPGQK-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|