C11H22N2 — CID 163400517
ethane;N-ethyl-1,4-dimethyl-3,4-dihydropyridin-2-imine (PubChem CID 163400517) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is ethane;N-ethyl-1,4-dimethyl-3,4-dihydropyridin-2-imine.
| Compound Name | ethane;N-ethyl-1,4-dimethyl-3,4-dihydropyridin-2-imine |
|---|---|
| PubChem CID | 163400517 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | ethane;N-ethyl-1,4-dimethyl-3,4-dihydropyridin-2-imine |
| SMILES | CC.CC/N=C1\CC(C)C=CN1C |
| InChI | InChI=1S/C9H16N2.C2H6/c1-4-10-9-7-8(2)5-6-11(9)3;1-2/h5-6,8H,4,7H2,1-3H3;1-2H3/b10-9+; |
| InChIKey | KHGMURKBANFPCE-RRABGKBLSA-N |
| XLogP | 2.92 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|