C12H24N2 — CID 142616651
N,4-dimethyl-1-propan-2-yl-3,4-dihydropyridin-2-imine;ethane (PubChem CID 142616651) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is N,4-dimethyl-1-propan-2-yl-3,4-dihydropyridin-2-imine;ethane.
| Compound Name | N,4-dimethyl-1-propan-2-yl-3,4-dihydropyridin-2-imine;ethane |
|---|---|
| PubChem CID | 142616651 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | N,4-dimethyl-1-propan-2-yl-3,4-dihydropyridin-2-imine;ethane |
| SMILES | C/N=C1\CC(C)C=CN1C(C)C.CC |
| InChI | InChI=1S/C10H18N2.C2H6/c1-8(2)12-6-5-9(3)7-10(12)11-4;1-2/h5-6,8-9H,7H2,1-4H3;1-2H3/b11-10+; |
| InChIKey | ZFDPYACPTMXGOE-ASTDGNLGSA-N |
| XLogP | 3.30 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|