C32H41N7O — CID 142123987
N-[2-[4-[2-[(3-amino-3-ethenyliminopropyl)-(6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-9-yl)amino]ethyl]phenyl]ethyl]-4,6-dimethylpyrimidine-5-carboxamide (PubChem CID 142123987) has the molecular formula C32H41N7O and a molecular weight of 539.73 g/mol. Its IUPAC name is N-[2-[4-[2-[(3-amino-3-ethenyliminopropyl)-(6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-9-yl)amino]ethyl]phenyl]ethyl]-4,6-dimethylpyrimidine-5-carboxamide.
| Compound Name | N-[2-[4-[2-[(3-amino-3-ethenyliminopropyl)-(6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-9-yl)amino]ethyl]phenyl]ethyl]-4,6-dimethylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 142123987 |
| Molecular Formula | C32H41N7O |
| Molecular Weight | 539.73 g/mol |
| Exact Mass | 539.34 |
| IUPAC Name | N-[2-[4-[2-[(3-amino-3-ethenyliminopropyl)-(6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-9-yl)amino]ethyl]phenyl]ethyl]-4,6-dimethylpyrimidine-5-carboxamide |
| SMILES | C=C/N=C(\N)CCN(CCc1ccc(CCNC(=O)c2c(C)ncnc2C)cc1)C1CCCCc2cccnc21 |
| InChI | InChI=1S/C32H41N7O/c1-4-34-29(33)17-21-39(28-10-6-5-8-27-9-7-18-35-31(27)28)20-16-26-13-11-25(12-14-26)15-19-36-32(40)30-23(2)37-22-38-24(30)3/h4,7,9,11-14,18,22,28H,1,5-6,8,10,15-17,19-21H2,2-3H3,(H2,33,34)(H,36,40) |
| InChIKey | YIPOASLJEFZZEP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.73 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|