C27H26FN5 — CID 142127649
N-[2-(2-ethenylbenzenecarboximidoyl)-1,2-dihydroquinazolin-4-yl]-N'-ethyl-5-fluoro-2-methylbenzenecarboximidamide (PubChem CID 142127649) has the molecular formula C27H26FN5 and a molecular weight of 439.54 g/mol. Its IUPAC name is N-[2-(2-ethenylbenzenecarboximidoyl)-1,2-dihydroquinazolin-4-yl]-N'-ethyl-5-fluoro-2-methylbenzenecarboximidamide.
| Compound Name | N-[2-(2-ethenylbenzenecarboximidoyl)-1,2-dihydroquinazolin-4-yl]-N'-ethyl-5-fluoro-2-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 142127649 |
| Molecular Formula | C27H26FN5 |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | N-[2-(2-ethenylbenzenecarboximidoyl)-1,2-dihydroquinazolin-4-yl]-N'-ethyl-5-fluoro-2-methylbenzenecarboximidamide |
| SMILES | [H]/N=C(\c1ccccc1C=C)C1N=C(N/C(=N/CC)c2cc(F)ccc2C)c2ccccc2N1 |
| InChI | InChI=1S/C27H26FN5/c1-4-18-10-6-7-11-20(18)24(29)27-31-23-13-9-8-12-21(23)26(33-27)32-25(30-5-2)22-16-19(28)15-14-17(22)3/h4,6-16,27,29,31H,1,5H2,2-3H3,(H,30,32,33)/b29-24+ |
| InChIKey | RWYVLSDPDPFHSO-RMLRFSFXSA-N |
| XLogP | 5.40 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|