C29H31BFN3 — CID 142160144
acetylene;benzene;2-cyclopropyl-N-[1-(2-dimethylboranyl-5-fluorophenyl)ethenyl]-1,2-dihydroquinazolin-4-amine (PubChem CID 142160144) has the molecular formula C29H31BFN3 and a molecular weight of 451.40 g/mol. Its IUPAC name is acetylene;benzene;2-cyclopropyl-N-[1-(2-dimethylboranyl-5-fluorophenyl)ethenyl]-1,2-dihydroquinazolin-4-amine.
| Compound Name | acetylene;benzene;2-cyclopropyl-N-[1-(2-dimethylboranyl-5-fluorophenyl)ethenyl]-1,2-dihydroquinazolin-4-amine |
|---|---|
| PubChem CID | 142160144 |
| Molecular Formula | C29H31BFN3 |
| Molecular Weight | 451.40 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | acetylene;benzene;2-cyclopropyl-N-[1-(2-dimethylboranyl-5-fluorophenyl)ethenyl]-1,2-dihydroquinazolin-4-amine |
| SMILES | C#C.C=C(NC1=NC(C2CC2)Nc2ccccc21)c1cc(F)ccc1B(C)C.c1ccccc1 |
| InChI | InChI=1S/C21H23BFN3.C6H6.C2H2/c1-13(17-12-15(23)10-11-18(17)22(2)3)24-21-16-6-4-5-7-19(16)25-20(26-21)14-8-9-14;1-2-4-6-5-3-1;1-2/h4-7,10-12,14,20,25H,1,8-9H2,2-3H3,(H,24,26);1-6H;1-2H |
| InChIKey | NLUSHDVBRRZGQT-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.40 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|