C12H17F3N2 — CID 142128670
1-methyl-4-[(3E)-4-(trifluoromethyl)hexa-1,3,5-trien-2-yl]piperazine (PubChem CID 142128670) has the molecular formula C12H17F3N2 and a molecular weight of 246.28 g/mol. Its IUPAC name is 1-methyl-4-[(3E)-4-(trifluoromethyl)hexa-1,3,5-trien-2-yl]piperazine.
| Compound Name | 1-methyl-4-[(3E)-4-(trifluoromethyl)hexa-1,3,5-trien-2-yl]piperazine |
|---|---|
| PubChem CID | 142128670 |
| Molecular Formula | C12H17F3N2 |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 1-methyl-4-[(3E)-4-(trifluoromethyl)hexa-1,3,5-trien-2-yl]piperazine |
| SMILES | C=C/C(=C\C(=C)N1CCN(C)CC1)C(F)(F)F |
| InChI | InChI=1S/C12H17F3N2/c1-4-11(12(13,14)15)9-10(2)17-7-5-16(3)6-8-17/h4,9H,1-2,5-8H2,3H3/b11-9+ |
| InChIKey | UTXLQTQXPMEJCW-PKNBQFBNSA-N |
| XLogP | 2.42 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|