C16H17N5 — CID 142128761
2-amino-6-phenyl-4-piperazin-1-ylpyridine-3-carbonitrile (PubChem CID 142128761) has the molecular formula C16H17N5 and a molecular weight of 279.35 g/mol. Its IUPAC name is 2-amino-6-phenyl-4-piperazin-1-ylpyridine-3-carbonitrile.
| Compound Name | 2-amino-6-phenyl-4-piperazin-1-ylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 142128761 |
| Molecular Formula | C16H17N5 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 2-amino-6-phenyl-4-piperazin-1-ylpyridine-3-carbonitrile |
| SMILES | N#Cc1c(N2CCNCC2)cc(-c2ccccc2)nc1N |
| InChI | InChI=1S/C16H17N5/c17-11-13-15(21-8-6-19-7-9-21)10-14(20-16(13)18)12-4-2-1-3-5-12/h1-5,10,19H,6-9H2,(H2,18,20) |
| InChIKey | STMOLAMTIFUJTL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 77.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |