C29H41N3O3 — CID 142128789
2-[[6-[2-(2-cyclopropylethyl)-6-hydroxyphenyl]-2-methyl-4-piperidin-3-yl-3-pyridinyl]methyl]-3-oxobutanamide;ethane (PubChem CID 142128789) has the molecular formula C29H41N3O3 and a molecular weight of 479.67 g/mol. Its IUPAC name is 2-[[6-[2-(2-cyclopropylethyl)-6-hydroxyphenyl]-2-methyl-4-piperidin-3-yl-3-pyridinyl]methyl]-3-oxobutanamide;ethane.
| Compound Name | 2-[[6-[2-(2-cyclopropylethyl)-6-hydroxyphenyl]-2-methyl-4-piperidin-3-yl-3-pyridinyl]methyl]-3-oxobutanamide;ethane |
|---|---|
| PubChem CID | 142128789 |
| Molecular Formula | C29H41N3O3 |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 479.31 |
| IUPAC Name | 2-[[6-[2-(2-cyclopropylethyl)-6-hydroxyphenyl]-2-methyl-4-piperidin-3-yl-3-pyridinyl]methyl]-3-oxobutanamide;ethane |
| SMILES | CC.CC(=O)C(Cc1c(C2CCCNC2)cc(-c2c(O)cccc2CCC2CC2)nc1C)C(N)=O |
| InChI | InChI=1S/C27H35N3O3.C2H6/c1-16-21(13-22(17(2)31)27(28)33)23(20-6-4-12-29-15-20)14-24(30-16)26-19(5-3-7-25(26)32)11-10-18-8-9-18;1-2/h3,5,7,14,18,20,22,29,32H,4,6,8-13,15H2,1-2H3,(H2,28,33);1-2H3 |
| InChIKey | AUSYXJCNWYVIEC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|