C24H43N5O3S3 — CID 142135868
1-ethyl-3-[4-[3-[3-(5-ethyl-2-methylimino-4-sulfanylidene-1,3,5-oxadiazinan-3-yl)-3-methylbutoxy]propoxy]-2-methylbutan-2-yl]imidazolidine-2,4-dithione (PubChem CID 142135868) has the molecular formula C24H43N5O3S3 and a molecular weight of 545.84 g/mol. Its IUPAC name is 1-ethyl-3-[4-[3-[3-(5-ethyl-2-methylimino-4-sulfanylidene-1,3,5-oxadiazinan-3-yl)-3-methylbutoxy]propoxy]-2-methylbutan-2-yl]imidazolidine-2,4-dithione.
| Compound Name | 1-ethyl-3-[4-[3-[3-(5-ethyl-2-methylimino-4-sulfanylidene-1,3,5-oxadiazinan-3-yl)-3-methylbutoxy]propoxy]-2-methylbutan-2-yl]imidazolidine-2,4-dithione |
|---|---|
| PubChem CID | 142135868 |
| Molecular Formula | C24H43N5O3S3 |
| Molecular Weight | 545.84 g/mol |
| Exact Mass | 545.25 |
| IUPAC Name | 1-ethyl-3-[4-[3-[3-(5-ethyl-2-methylimino-4-sulfanylidene-1,3,5-oxadiazinan-3-yl)-3-methylbutoxy]propoxy]-2-methylbutan-2-yl]imidazolidine-2,4-dithione |
| SMILES | CCN1CC(=S)N(C(C)(C)CCOCCCOCCC(C)(C)N2C(=S)N(CC)CO/C2=N\C)C1=S |
| InChI | InChI=1S/C24H43N5O3S3/c1-8-26-17-19(33)28(21(26)34)23(3,4)11-15-30-13-10-14-31-16-12-24(5,6)29-20(25-7)32-18-27(9-2)22(29)35/h8-18H2,1-7H3/b25-20- |
| InChIKey | BWILQPCMNWJFQY-QQTULTPQSA-N |
| XLogP | 3.88 |
| TPSA | 53.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.84 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|