About 8H-cyclohepta[c]pyridine;ethane
8H-cyclohepta[c]pyridine;ethane (PubChem CID 142141747) has the molecular formula C12H15N
and a molecular weight of 173.26 g/mol. Its IUPAC name is 8H-cyclohepta[c]pyridine;ethane.
Molecular Properties
| Compound Name | 8H-cyclohepta[c]pyridine;ethane |
| PubChem CID | 142141747 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 8H-cyclohepta[c]pyridine;ethane |
| SMILES | C1=CCC=c2cnccc2=C1.CC |
| InChI | InChI=1S/C10H9N.C2H6/c1-2-4-9-6-7-11-8-10(9)5-3-1;1-2/h1-2,4-8H,3H2;1-2H3 |
| InChIKey | APSVXZZZXJCRLZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8H-cyclohepta[c]pyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8H-cyclohepta[c]pyridine;ethane?
The IUPAC name of 8H-cyclohepta[c]pyridine;ethane (CID 142141747) is 8H-cyclohepta[c]pyridine;ethane.
What is the SMILES notation for 8H-cyclohepta[c]pyridine;ethane?
The canonical SMILES for 8H-cyclohepta[c]pyridine;ethane is C1=CCC=c2cnccc2=C1.CC.
What is the InChIKey of 8H-cyclohepta[c]pyridine;ethane?
The InChIKey is APSVXZZZXJCRLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N.C2H6/c1-2-4-9-6-7-11-8-10(9)5-3-1;1-2/h1-2,4-8H,3H2;1-2H3.
What are the key properties of 8H-cyclohepta[c]pyridine;ethane?
8H-cyclohepta[c]pyridine;ethane has a molecular weight of 173.26 g/mol, XLogP of 1.63, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8H-cyclohepta[c]pyridine;ethane is sourced from PubChem (CID 142141747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).