C28H37N7O2 — CID 142146075
3,4-bis[2-[3-(dimethylamino)propylamino]benzenecarboximidoyl]pyrrole-2,5-dione (PubChem CID 142146075) has the molecular formula C28H37N7O2 and a molecular weight of 503.65 g/mol. Its IUPAC name is 3,4-bis[2-[3-(dimethylamino)propylamino]benzenecarboximidoyl]pyrrole-2,5-dione.
| Compound Name | 3,4-bis[2-[3-(dimethylamino)propylamino]benzenecarboximidoyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 142146075 |
| Molecular Formula | C28H37N7O2 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.30 |
| IUPAC Name | 3,4-bis[2-[3-(dimethylamino)propylamino]benzenecarboximidoyl]pyrrole-2,5-dione |
| SMILES | [H]/N=C(\C1=C(/C(=N/[H])c2ccccc2NCCCN(C)C)C(=O)NC1=O)c1ccccc1NCCCN(C)C |
| InChI | InChI=1S/C28H37N7O2/c1-34(2)17-9-15-31-21-13-7-5-11-19(21)25(29)23-24(28(37)33-27(23)36)26(30)20-12-6-8-14-22(20)32-16-10-18-35(3)4/h5-8,11-14,29-32H,9-10,15-18H2,1-4H3,(H,33,36,37)/b29-25-,30-26+ |
| InChIKey | OJTIRNDDBGGLKH-ZUSIYWPSSA-N |
| XLogP | 2.80 |
| TPSA | 124.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|