C29H33N3O6 — CID 142146107
3-[5-ethenyl-1-[2-(2-hydroxyethoxy)ethyl]-4-[(Z)-prop-1-enyl]pyrrol-3-yl]-4-[1-[2-(2-hydroxyethoxy)ethyl]indol-3-yl]pyrrole-2,5-dione (PubChem CID 142146107) has the molecular formula C29H33N3O6 and a molecular weight of 519.60 g/mol. Its IUPAC name is 3-[5-ethenyl-1-[2-(2-hydroxyethoxy)ethyl]-4-[(Z)-prop-1-enyl]pyrrol-3-yl]-4-[1-[2-(2-hydroxyethoxy)ethyl]indol-3-yl]pyrrole-2,5-dione.
| Compound Name | 3-[5-ethenyl-1-[2-(2-hydroxyethoxy)ethyl]-4-[(Z)-prop-1-enyl]pyrrol-3-yl]-4-[1-[2-(2-hydroxyethoxy)ethyl]indol-3-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 142146107 |
| Molecular Formula | C29H33N3O6 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | 3-[5-ethenyl-1-[2-(2-hydroxyethoxy)ethyl]-4-[(Z)-prop-1-enyl]pyrrol-3-yl]-4-[1-[2-(2-hydroxyethoxy)ethyl]indol-3-yl]pyrrole-2,5-dione |
| SMILES | C=Cc1c(/C=C\C)c(C2=C(c3cn(CCOCCO)c4ccccc34)C(=O)NC2=O)cn1CCOCCO |
| InChI | InChI=1S/C29H33N3O6/c1-3-7-20-22(18-31(24(20)4-2)10-14-37-16-12-33)26-27(29(36)30-28(26)35)23-19-32(11-15-38-17-13-34)25-9-6-5-8-21(23)25/h3-9,18-19,33-34H,2,10-17H2,1H3,(H,30,35,36)/b7-3- |
| InChIKey | VPOJERJIVQWXKY-CLTKARDFSA-N |
| XLogP | 2.70 |
| TPSA | 114.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|