C22H18N4O3 — CID 69374015
3-[1-(3-hydroxypropyl)indol-3-yl]-4-imidazo[1,2-a]pyridin-5-ylpyrrole-2,5-dione (PubChem CID 69374015) has the molecular formula C22H18N4O3 and a molecular weight of 386.41 g/mol. Its IUPAC name is 3-[1-(3-hydroxypropyl)indol-3-yl]-4-imidazo[1,2-a]pyridin-5-ylpyrrole-2,5-dione.
| Compound Name | 3-[1-(3-hydroxypropyl)indol-3-yl]-4-imidazo[1,2-a]pyridin-5-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 69374015 |
| Molecular Formula | C22H18N4O3 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 3-[1-(3-hydroxypropyl)indol-3-yl]-4-imidazo[1,2-a]pyridin-5-ylpyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2cccc3nccn23)=C1c1cn(CCCO)c2ccccc12 |
| InChI | InChI=1S/C22H18N4O3/c27-12-4-10-25-13-15(14-5-1-2-6-16(14)25)19-20(22(29)24-21(19)28)17-7-3-8-18-23-9-11-26(17)18/h1-3,5-9,11,13,27H,4,10,12H2,(H,24,28,29) |
| InChIKey | CBKFARGEWLMQQW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 88.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|