C13H14F3NO — CID 142147298
2-methoxy-N-[(3E)-5,5,5-trifluoro-4-methylpenta-1,3-dien-2-yl]aniline (PubChem CID 142147298) has the molecular formula C13H14F3NO and a molecular weight of 257.25 g/mol. Its IUPAC name is 2-methoxy-N-[(3E)-5,5,5-trifluoro-4-methylpenta-1,3-dien-2-yl]aniline.
| Compound Name | 2-methoxy-N-[(3E)-5,5,5-trifluoro-4-methylpenta-1,3-dien-2-yl]aniline |
|---|---|
| PubChem CID | 142147298 |
| Molecular Formula | C13H14F3NO |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 2-methoxy-N-[(3E)-5,5,5-trifluoro-4-methylpenta-1,3-dien-2-yl]aniline |
| SMILES | C=C(/C=C(\C)C(F)(F)F)Nc1ccccc1OC |
| InChI | InChI=1S/C13H14F3NO/c1-9(13(14,15)16)8-10(2)17-11-6-4-5-7-12(11)18-3/h4-8,17H,2H2,1,3H3/b9-8+ |
| InChIKey | QRCYCVXSZIUJJP-CMDGGOBGSA-N |
| XLogP | 4.13 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|