C27H27BrN6O6S2 — CID 142151192
5-(4-bromophenyl)-6-[2-(5-methoxypyrimidin-2-yl)oxyethoxy]-N-(thiophen-2-ylmethylsulfamoyl)pyrimidin-4-amine;2-methylfuran (PubChem CID 142151192) has the molecular formula C27H27BrN6O6S2 and a molecular weight of 675.59 g/mol. Its IUPAC name is 5-(4-bromophenyl)-6-[2-(5-methoxypyrimidin-2-yl)oxyethoxy]-N-(thiophen-2-ylmethylsulfamoyl)pyrimidin-4-amine;2-methylfuran.
| Compound Name | 5-(4-bromophenyl)-6-[2-(5-methoxypyrimidin-2-yl)oxyethoxy]-N-(thiophen-2-ylmethylsulfamoyl)pyrimidin-4-amine;2-methylfuran |
|---|---|
| PubChem CID | 142151192 |
| Molecular Formula | C27H27BrN6O6S2 |
| Molecular Weight | 675.59 g/mol |
| Exact Mass | 674.06 |
| IUPAC Name | 5-(4-bromophenyl)-6-[2-(5-methoxypyrimidin-2-yl)oxyethoxy]-N-(thiophen-2-ylmethylsulfamoyl)pyrimidin-4-amine;2-methylfuran |
| SMILES | COc1cnc(OCCOc2ncnc(NS(=O)(=O)NCc3cccs3)c2-c2ccc(Br)cc2)nc1.Cc1ccco1 |
| InChI | InChI=1S/C22H21BrN6O5S2.C5H6O/c1-32-17-11-24-22(25-12-17)34-9-8-33-21-19(15-4-6-16(23)7-5-15)20(26-14-27-21)29-36(30,31)28-13-18-3-2-10-35-18;1-5-3-2-4-6-5/h2-7,10-12,14,28H,8-9,13H2,1H3,(H,26,27,29);2-4H,1H3 |
| InChIKey | NWKCVOICCRWZEB-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.59 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|