C18H14ClN7O2 — CID 142152936
2-[5-(aziridin-1-yl)-7-(furan-2-yl)triazolo[4,5-d]pyrimidin-3-yl]-N-(3-chlorophenyl)acetamide (PubChem CID 142152936) has the molecular formula C18H14ClN7O2 and a molecular weight of 395.81 g/mol. Its IUPAC name is 2-[5-(aziridin-1-yl)-7-(furan-2-yl)triazolo[4,5-d]pyrimidin-3-yl]-N-(3-chlorophenyl)acetamide.
| Compound Name | 2-[5-(aziridin-1-yl)-7-(furan-2-yl)triazolo[4,5-d]pyrimidin-3-yl]-N-(3-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 142152936 |
| Molecular Formula | C18H14ClN7O2 |
| Molecular Weight | 395.81 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 2-[5-(aziridin-1-yl)-7-(furan-2-yl)triazolo[4,5-d]pyrimidin-3-yl]-N-(3-chlorophenyl)acetamide |
| SMILES | O=C(Cn1nnc2c(-c3ccco3)nc(N3CC3)nc21)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H14ClN7O2/c19-11-3-1-4-12(9-11)20-14(27)10-26-17-16(23-24-26)15(13-5-2-8-28-13)21-18(22-17)25-6-7-25/h1-5,8-9H,6-7,10H2,(H,20,27) |
| InChIKey | JUMMAGXJJYITRD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.81 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|