C29H41N3O5 — CID 142155271
4-[[(3Z,5Z)-3-tert-butylhepta-1,3,5-trien-2-yl]amino]-N-[1-oxo-1-[(5-oxo-2-phenylmethoxyoxolan-3-yl)amino]propan-2-yl]butanamide (PubChem CID 142155271) has the molecular formula C29H41N3O5 and a molecular weight of 511.66 g/mol. Its IUPAC name is 4-[[(3Z,5Z)-3-tert-butylhepta-1,3,5-trien-2-yl]amino]-N-[1-oxo-1-[(5-oxo-2-phenylmethoxyoxolan-3-yl)amino]propan-2-yl]butanamide.
| Compound Name | 4-[[(3Z,5Z)-3-tert-butylhepta-1,3,5-trien-2-yl]amino]-N-[1-oxo-1-[(5-oxo-2-phenylmethoxyoxolan-3-yl)amino]propan-2-yl]butanamide |
|---|---|
| PubChem CID | 142155271 |
| Molecular Formula | C29H41N3O5 |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.30 |
| IUPAC Name | 4-[[(3Z,5Z)-3-tert-butylhepta-1,3,5-trien-2-yl]amino]-N-[1-oxo-1-[(5-oxo-2-phenylmethoxyoxolan-3-yl)amino]propan-2-yl]butanamide |
| SMILES | C=C(NCCCC(=O)NC(C)C(=O)NC1CC(=O)OC1OCc1ccccc1)/C(=C\C=C/C)C(C)(C)C |
| InChI | InChI=1S/C29H41N3O5/c1-7-8-15-23(29(4,5)6)20(2)30-17-12-16-25(33)31-21(3)27(35)32-24-18-26(34)37-28(24)36-19-22-13-10-9-11-14-22/h7-11,13-15,21,24,28,30H,2,12,16-19H2,1,3-6H3,(H,31,33)(H,32,35)/b8-7-,23-15+ |
| InChIKey | QCFVDLNELTULEX-CVZAFKHNSA-N |
| XLogP | 3.90 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|