C29H36N4O7 — CID 163531536
N-[2-[[5-amino-1-oxo-1-[(5-oxo-2-phenylmethoxyoxolan-3-yl)amino]pentan-2-yl]carbamoyl]-5-oxopentyl]benzamide (PubChem CID 163531536) has the molecular formula C29H36N4O7 and a molecular weight of 552.63 g/mol. Its IUPAC name is N-[2-[[5-amino-1-oxo-1-[(5-oxo-2-phenylmethoxyoxolan-3-yl)amino]pentan-2-yl]carbamoyl]-5-oxopentyl]benzamide.
| Compound Name | N-[2-[[5-amino-1-oxo-1-[(5-oxo-2-phenylmethoxyoxolan-3-yl)amino]pentan-2-yl]carbamoyl]-5-oxopentyl]benzamide |
|---|---|
| PubChem CID | 163531536 |
| Molecular Formula | C29H36N4O7 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | N-[2-[[5-amino-1-oxo-1-[(5-oxo-2-phenylmethoxyoxolan-3-yl)amino]pentan-2-yl]carbamoyl]-5-oxopentyl]benzamide |
| SMILES | NCCCC(NC(=O)C(CCC=O)CNC(=O)c1ccccc1)C(=O)NC1CC(=O)OC1OCc1ccccc1 |
| InChI | InChI=1S/C29H36N4O7/c30-15-7-14-23(28(38)33-24-17-25(35)40-29(24)39-19-20-9-3-1-4-10-20)32-27(37)22(13-8-16-34)18-31-26(36)21-11-5-2-6-12-21/h1-6,9-12,16,22-24,29H,7-8,13-15,17-19,30H2,(H,31,36)(H,32,37)(H,33,38) |
| InChIKey | DTKIWEDJLKINDS-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 165.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|