C25H18F3NO2 — CID 142157476
N-[3-(naphthalen-1-ylmethoxy)phenyl]-3-(trifluoromethyl)benzamide (PubChem CID 142157476) has the molecular formula C25H18F3NO2 and a molecular weight of 421.42 g/mol. Its IUPAC name is N-[3-(naphthalen-1-ylmethoxy)phenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[3-(naphthalen-1-ylmethoxy)phenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 142157476 |
| Molecular Formula | C25H18F3NO2 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | N-[3-(naphthalen-1-ylmethoxy)phenyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1cccc(OCc2cccc3ccccc23)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H18F3NO2/c26-25(27,28)20-10-4-8-18(14-20)24(30)29-21-11-5-12-22(15-21)31-16-19-9-3-7-17-6-1-2-13-23(17)19/h1-15H,16H2,(H,29,30) |
| InChIKey | FHAKOWBZKVHZJV-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |