About N-ethenyl-N'-methylpiperazine-1-carboximidamide;molecular hydrogen
N-ethenyl-N'-methylpiperazine-1-carboximidamide;molecular hydrogen (PubChem CID 142160666) has the molecular formula C8H18N4
and a molecular weight of 170.26 g/mol. Its IUPAC name is N-ethenyl-N'-methylpiperazine-1-carboximidamide;molecular hydrogen.
Molecular Properties
| Compound Name | N-ethenyl-N'-methylpiperazine-1-carboximidamide;molecular hydrogen |
| PubChem CID | 142160666 |
| Molecular Formula | C8H18N4 |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.15 |
| IUPAC Name | N-ethenyl-N'-methylpiperazine-1-carboximidamide;molecular hydrogen |
| SMILES | C=CN/C(=N\C)N1CCNCC1.[H][H] |
| InChI | InChI=1S/C8H16N4.H2/c1-3-11-8(9-2)12-6-4-10-5-7-12;/h3,10H,1,4-7H2,2H3,(H,9,11);1H |
| InChIKey | FLLIDHLJLVWUHQ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-ethenyl-N'-methylpiperazine-1-carboximidamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyl-N'-methylpiperazine-1-carboximidamide;molecular hydrogen?
The IUPAC name of N-ethenyl-N'-methylpiperazine-1-carboximidamide;molecular hydrogen (CID 142160666) is N-ethenyl-N'-methylpiperazine-1-carboximidamide;molecular hydrogen.
What is the SMILES notation for N-ethenyl-N'-methylpiperazine-1-carboximidamide;molecular hydrogen?
The canonical SMILES for N-ethenyl-N'-methylpiperazine-1-carboximidamide;molecular hydrogen is C=CN/C(=N\C)N1CCNCC1.[H][H].
What is the InChIKey of N-ethenyl-N'-methylpiperazine-1-carboximidamide;molecular hydrogen?
The InChIKey is FLLIDHLJLVWUHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N4.H2/c1-3-11-8(9-2)12-6-4-10-5-7-12;/h3,10H,1,4-7H2,2H3,(H,9,11);1H.
What are the key properties of N-ethenyl-N'-methylpiperazine-1-carboximidamide;molecular hydrogen?
N-ethenyl-N'-methylpiperazine-1-carboximidamide;molecular hydrogen has a molecular weight of 170.26 g/mol, XLogP of -0.14, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-N'-methylpiperazine-1-carboximidamide;molecular hydrogen is sourced from PubChem (CID 142160666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).