About 2-(6-benzylsulfanylcyclohexa-2,4-dien-1-yl)-4,5-dihydro-1H-imidazole
2-(6-benzylsulfanylcyclohexa-2,4-dien-1-yl)-4,5-dihydro-1H-imidazole (PubChem CID 142160802) has the molecular formula C16H18N2S
and a molecular weight of 270.40 g/mol. Its IUPAC name is 2-(6-benzylsulfanylcyclohexa-2,4-dien-1-yl)-4,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 2-(6-benzylsulfanylcyclohexa-2,4-dien-1-yl)-4,5-dihydro-1H-imidazole |
| PubChem CID | 142160802 |
| Molecular Formula | C16H18N2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-(6-benzylsulfanylcyclohexa-2,4-dien-1-yl)-4,5-dihydro-1H-imidazole |
| SMILES | C1=CC(SCc2ccccc2)C(C2=NCCN2)C=C1 |
| InChI | InChI=1S/C16H18N2S/c1-2-6-13(7-3-1)12-19-15-9-5-4-8-14(15)16-17-10-11-18-16/h1-9,14-15H,10-12H2,(H,17,18) |
| InChIKey | LYFRAFOXDLYWQL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(6-benzylsulfanylcyclohexa-2,4-dien-1-yl)-4,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-benzylsulfanylcyclohexa-2,4-dien-1-yl)-4,5-dihydro-1H-imidazole?
The IUPAC name of 2-(6-benzylsulfanylcyclohexa-2,4-dien-1-yl)-4,5-dihydro-1H-imidazole (CID 142160802) is 2-(6-benzylsulfanylcyclohexa-2,4-dien-1-yl)-4,5-dihydro-1H-imidazole.
What is the SMILES notation for 2-(6-benzylsulfanylcyclohexa-2,4-dien-1-yl)-4,5-dihydro-1H-imidazole?
The canonical SMILES for 2-(6-benzylsulfanylcyclohexa-2,4-dien-1-yl)-4,5-dihydro-1H-imidazole is C1=CC(SCc2ccccc2)C(C2=NCCN2)C=C1.
What is the InChIKey of 2-(6-benzylsulfanylcyclohexa-2,4-dien-1-yl)-4,5-dihydro-1H-imidazole?
The InChIKey is LYFRAFOXDLYWQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2S/c1-2-6-13(7-3-1)12-19-15-9-5-4-8-14(15)16-17-10-11-18-16/h1-9,14-15H,10-12H2,(H,17,18).
What are the key properties of 2-(6-benzylsulfanylcyclohexa-2,4-dien-1-yl)-4,5-dihydro-1H-imidazole?
2-(6-benzylsulfanylcyclohexa-2,4-dien-1-yl)-4,5-dihydro-1H-imidazole has a molecular weight of 270.40 g/mol, XLogP of 3.03, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-benzylsulfanylcyclohexa-2,4-dien-1-yl)-4,5-dihydro-1H-imidazole is sourced from PubChem (CID 142160802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).