C10H13NS2 — CID 130012438
2-benzylsulfanyl-1,3-thiazolidine (PubChem CID 130012438) has the molecular formula C10H13NS2 and a molecular weight of 211.36 g/mol. Its IUPAC name is 2-benzylsulfanyl-1,3-thiazolidine.
| Compound Name | 2-benzylsulfanyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 130012438 |
| Molecular Formula | C10H13NS2 |
| Molecular Weight | 211.36 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | 2-benzylsulfanyl-1,3-thiazolidine |
| SMILES | c1ccc(CSC2NCCS2)cc1 |
| InChI | InChI=1S/C10H13NS2/c1-2-4-9(5-3-1)8-13-10-11-6-7-12-10/h1-5,10-11H,6-8H2 |
| InChIKey | XPOCDKXRYWYVKD-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |