C17H19N3O2 — CID 142162011
N-benzyl-4-(2-cyanoacetyl)-1H-pyrrole-2-carboxamide;ethane (PubChem CID 142162011) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is N-benzyl-4-(2-cyanoacetyl)-1H-pyrrole-2-carboxamide;ethane.
| Compound Name | N-benzyl-4-(2-cyanoacetyl)-1H-pyrrole-2-carboxamide;ethane |
|---|---|
| PubChem CID | 142162011 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-benzyl-4-(2-cyanoacetyl)-1H-pyrrole-2-carboxamide;ethane |
| SMILES | CC.N#CCC(=O)c1c[nH]c(C(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C15H13N3O2.C2H6/c16-7-6-14(19)12-8-13(17-10-12)15(20)18-9-11-4-2-1-3-5-11;1-2/h1-5,8,10,17H,6,9H2,(H,18,20);1-2H3 |
| InChIKey | XPMHIKFIHQNAFI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |