About methane;methanol;2-(1-phenylbut-3-en-2-ylamino)pentanal
methane;methanol;2-(1-phenylbut-3-en-2-ylamino)pentanal (PubChem CID 142163742) has the molecular formula C17H29NO2
and a molecular weight of 279.42 g/mol. Its IUPAC name is methane;methanol;2-(1-phenylbut-3-en-2-ylamino)pentanal.
Molecular Properties
| Compound Name | methane;methanol;2-(1-phenylbut-3-en-2-ylamino)pentanal |
| PubChem CID | 142163742 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | methane;methanol;2-(1-phenylbut-3-en-2-ylamino)pentanal |
| SMILES | C.C=CC(Cc1ccccc1)NC(C=O)CCC.CO |
| InChI | InChI=1S/C15H21NO.CH4O.CH4/c1-3-8-15(12-17)16-14(4-2)11-13-9-6-5-7-10-13;1-2;/h4-7,9-10,12,14-16H,2-3,8,11H2,1H3;2H,1H3;1H4 |
| InChIKey | BNDALLPTKYHWRE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methane;methanol;2-(1-phenylbut-3-en-2-ylamino)pentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;methanol;2-(1-phenylbut-3-en-2-ylamino)pentanal?
The IUPAC name of methane;methanol;2-(1-phenylbut-3-en-2-ylamino)pentanal (CID 142163742) is methane;methanol;2-(1-phenylbut-3-en-2-ylamino)pentanal.
What is the SMILES notation for methane;methanol;2-(1-phenylbut-3-en-2-ylamino)pentanal?
The canonical SMILES for methane;methanol;2-(1-phenylbut-3-en-2-ylamino)pentanal is C.C=CC(Cc1ccccc1)NC(C=O)CCC.CO.
What is the InChIKey of methane;methanol;2-(1-phenylbut-3-en-2-ylamino)pentanal?
The InChIKey is BNDALLPTKYHWRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO.CH4O.CH4/c1-3-8-15(12-17)16-14(4-2)11-13-9-6-5-7-10-13;1-2;/h4-7,9-10,12,14-16H,2-3,8,11H2,1H3;2H,1H3;1H4.
What are the key properties of methane;methanol;2-(1-phenylbut-3-en-2-ylamino)pentanal?
methane;methanol;2-(1-phenylbut-3-en-2-ylamino)pentanal has a molecular weight of 279.42 g/mol, XLogP of 2.99, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;methanol;2-(1-phenylbut-3-en-2-ylamino)pentanal is sourced from PubChem (CID 142163742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).