C15H13F7N4O2S — CID 142164725
2-[2-(2,2,3,3,4,4,4-heptafluorobutoxy)prop-2-enylsulfanyl]-4-(4-methoxypyrazol-1-yl)pyrimidine (PubChem CID 142164725) has the molecular formula C15H13F7N4O2S and a molecular weight of 446.35 g/mol. Its IUPAC name is 2-[2-(2,2,3,3,4,4,4-heptafluorobutoxy)prop-2-enylsulfanyl]-4-(4-methoxypyrazol-1-yl)pyrimidine.
| Compound Name | 2-[2-(2,2,3,3,4,4,4-heptafluorobutoxy)prop-2-enylsulfanyl]-4-(4-methoxypyrazol-1-yl)pyrimidine |
|---|---|
| PubChem CID | 142164725 |
| Molecular Formula | C15H13F7N4O2S |
| Molecular Weight | 446.35 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | 2-[2-(2,2,3,3,4,4,4-heptafluorobutoxy)prop-2-enylsulfanyl]-4-(4-methoxypyrazol-1-yl)pyrimidine |
| SMILES | C=C(CSc1nccc(-n2cc(OC)cn2)n1)OCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H13F7N4O2S/c1-9(28-8-13(16,17)14(18,19)15(20,21)22)7-29-12-23-4-3-11(25-12)26-6-10(27-2)5-24-26/h3-6H,1,7-8H2,2H3 |
| InChIKey | TXQJOBFUDDSRDF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.35 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|