C15H14F7N5O3 — CID 23545985
2,2,3,3,4,4,4-heptafluorobutyl 2-[[4-(4-methoxypyrazol-1-yl)pyrimidin-2-yl]-methylamino]acetate (PubChem CID 23545985) has the molecular formula C15H14F7N5O3 and a molecular weight of 445.30 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluorobutyl 2-[[4-(4-methoxypyrazol-1-yl)pyrimidin-2-yl]-methylamino]acetate.
| Compound Name | 2,2,3,3,4,4,4-heptafluorobutyl 2-[[4-(4-methoxypyrazol-1-yl)pyrimidin-2-yl]-methylamino]acetate |
|---|---|
| PubChem CID | 23545985 |
| Molecular Formula | C15H14F7N5O3 |
| Molecular Weight | 445.30 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutyl 2-[[4-(4-methoxypyrazol-1-yl)pyrimidin-2-yl]-methylamino]acetate |
| SMILES | COc1cnn(-c2ccnc(N(C)CC(=O)OCC(F)(F)C(F)(F)C(F)(F)F)n2)c1 |
| InChI | InChI=1S/C15H14F7N5O3/c1-26(7-11(28)30-8-13(16,17)14(18,19)15(20,21)22)12-23-4-3-10(25-12)27-6-9(29-2)5-24-27/h3-6H,7-8H2,1-2H3 |
| InChIKey | QSBHHMIDEFJPQR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 82.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.30 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|