C16H23N3O4 — CID 142166585
(Z)-6-ethenyliminohept-4-enoic acid;(E)-2-methyl-3-[1-(methylideneamino)ethylideneamino]prop-2-enoic acid (PubChem CID 142166585) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is (Z)-6-ethenyliminohept-4-enoic acid;(E)-2-methyl-3-[1-(methylideneamino)ethylideneamino]prop-2-enoic acid.
| Compound Name | (Z)-6-ethenyliminohept-4-enoic acid;(E)-2-methyl-3-[1-(methylideneamino)ethylideneamino]prop-2-enoic acid |
|---|---|
| PubChem CID | 142166585 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | (Z)-6-ethenyliminohept-4-enoic acid;(E)-2-methyl-3-[1-(methylideneamino)ethylideneamino]prop-2-enoic acid |
| SMILES | C=C/N=C(C)/C=C\CCC(=O)O.C=N/C(C)=N/C=C(\C)C(=O)O |
| InChI | InChI=1S/C9H13NO2.C7H10N2O2/c1-3-10-8(2)6-4-5-7-9(11)12;1-5(7(10)11)4-9-6(2)8-3/h3-4,6H,1,5,7H2,2H3,(H,11,12);4H,3H2,1-2H3,(H,10,11)/b6-4-,10-8+;5-4+,9-6+ |
| InChIKey | IDATUUCKQCADCW-CRKGLAQCSA-N |
| XLogP | 3.11 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|