C24H38N2O3 — CID 142167427
tert-butyl 3-[5-(N-propanoylanilino)pentyl]piperidine-1-carboxylate (PubChem CID 142167427) has the molecular formula C24H38N2O3 and a molecular weight of 402.58 g/mol. Its IUPAC name is tert-butyl 3-[5-(N-propanoylanilino)pentyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[5-(N-propanoylanilino)pentyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142167427 |
| Molecular Formula | C24H38N2O3 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.29 |
| IUPAC Name | tert-butyl 3-[5-(N-propanoylanilino)pentyl]piperidine-1-carboxylate |
| SMILES | CCC(=O)N(CCCCCC1CCCN(C(=O)OC(C)(C)C)C1)c1ccccc1 |
| InChI | InChI=1S/C24H38N2O3/c1-5-22(27)26(21-15-9-6-10-16-21)18-11-7-8-13-20-14-12-17-25(19-20)23(28)29-24(2,3)4/h6,9-10,15-16,20H,5,7-8,11-14,17-19H2,1-4H3 |
| InChIKey | MDYHYORAHKXDAJ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|