C15H29N3 — CID 142170699
N,N'-dimethyl-N'-[1-[(Z)-[(E)-3-methyl-2-methylidenepent-3-enylidene]amino]ethenyl]ethane-1,2-diamine;ethane (PubChem CID 142170699) has the molecular formula C15H29N3 and a molecular weight of 251.42 g/mol. Its IUPAC name is N,N'-dimethyl-N'-[1-[(Z)-[(E)-3-methyl-2-methylidenepent-3-enylidene]amino]ethenyl]ethane-1,2-diamine;ethane.
| Compound Name | N,N'-dimethyl-N'-[1-[(Z)-[(E)-3-methyl-2-methylidenepent-3-enylidene]amino]ethenyl]ethane-1,2-diamine;ethane |
|---|---|
| PubChem CID | 142170699 |
| Molecular Formula | C15H29N3 |
| Molecular Weight | 251.42 g/mol |
| Exact Mass | 251.24 |
| IUPAC Name | N,N'-dimethyl-N'-[1-[(Z)-[(E)-3-methyl-2-methylidenepent-3-enylidene]amino]ethenyl]ethane-1,2-diamine;ethane |
| SMILES | C=C(/C=N\C(=C)N(C)CCNC)/C(C)=C/C.CC |
| InChI | InChI=1S/C13H23N3.C2H6/c1-7-11(2)12(3)10-15-13(4)16(6)9-8-14-5;1-2/h7,10,14H,3-4,8-9H2,1-2,5-6H3;1-2H3/b11-7+,15-10-; |
| InChIKey | FOBCAYFFHAYZNH-BSOYOXDHSA-N |
| XLogP | 3.23 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|