C19H27N3 — CID 142583784
(4Z,5Z)-4-[(Z,2E)-2-ethylidene-3-(ethyliminomethyl)pent-3-enylidene]-N-methyl-5-propylidenepyridin-2-amine (PubChem CID 142583784) has the molecular formula C19H27N3 and a molecular weight of 297.45 g/mol. Its IUPAC name is (4Z,5Z)-4-[(Z,2E)-2-ethylidene-3-(ethyliminomethyl)pent-3-enylidene]-N-methyl-5-propylidenepyridin-2-amine.
| Compound Name | (4Z,5Z)-4-[(Z,2E)-2-ethylidene-3-(ethyliminomethyl)pent-3-enylidene]-N-methyl-5-propylidenepyridin-2-amine |
|---|---|
| PubChem CID | 142583784 |
| Molecular Formula | C19H27N3 |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | (4Z,5Z)-4-[(Z,2E)-2-ethylidene-3-(ethyliminomethyl)pent-3-enylidene]-N-methyl-5-propylidenepyridin-2-amine |
| SMILES | C/C=C(\C=N\CC)C(/C=c1/cc(NC)nc/c1=C\CC)=C/C |
| InChI | InChI=1S/C19H27N3/c1-6-10-17-14-22-19(20-5)12-18(17)11-15(7-2)16(8-3)13-21-9-4/h7-8,10-14,20H,6,9H2,1-5H3/b15-7+,16-8+,17-10+,18-11-,21-13+ |
| InChIKey | VBRJCPASGIDBKQ-NKXAMLJPSA-N |
| XLogP | 3.08 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|