C11H18N3+ — CID 123599154
[4-(1-aminoethenyliminomethyl)-3-methylpenta-2,4-dienylidene]-dimethylazanium (PubChem CID 123599154) has the molecular formula C11H18N3+ and a molecular weight of 192.29 g/mol. Its IUPAC name is [4-(1-aminoethenyliminomethyl)-3-methylpenta-2,4-dienylidene]-dimethylazanium.
| Compound Name | [4-(1-aminoethenyliminomethyl)-3-methylpenta-2,4-dienylidene]-dimethylazanium |
|---|---|
| PubChem CID | 123599154 |
| Molecular Formula | C11H18N3+ |
| Molecular Weight | 192.29 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | [4-(1-aminoethenyliminomethyl)-3-methylpenta-2,4-dienylidene]-dimethylazanium |
| SMILES | C=C(N)N=CC(=C)C(C)=CC=[N+](C)C |
| InChI | InChI=1S/C11H18N3/c1-9(6-7-14(4)5)10(2)8-13-11(3)12/h6-8H,2-3,12H2,1,4-5H3/q+1 |
| InChIKey | DYHIRLBWSGNRSL-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 41.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|