C15H21N3 — CID 142583949
(4Z,5E)-5-ethylidene-N-methyl-4-[(Z)-3-(methyliminomethyl)pent-3-enylidene]pyridin-2-amine (PubChem CID 142583949) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is (4Z,5E)-5-ethylidene-N-methyl-4-[(Z)-3-(methyliminomethyl)pent-3-enylidene]pyridin-2-amine.
| Compound Name | (4Z,5E)-5-ethylidene-N-methyl-4-[(Z)-3-(methyliminomethyl)pent-3-enylidene]pyridin-2-amine |
|---|---|
| PubChem CID | 142583949 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | (4Z,5E)-5-ethylidene-N-methyl-4-[(Z)-3-(methyliminomethyl)pent-3-enylidene]pyridin-2-amine |
| SMILES | C/C=C(\C=N\C)C/C=c1/cc(NC)nc/c1=C/C |
| InChI | InChI=1S/C15H21N3/c1-5-12(10-16-3)7-8-14-9-15(17-4)18-11-13(14)6-2/h5-6,8-11,17H,7H2,1-4H3/b12-5-,13-6-,14-8-,16-10+ |
| InChIKey | FZXQKJKEPUWREA-OEJANELPSA-N |
| XLogP | 1.74 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|