C15H10 — CID 142172700
tetracyclo[10.2.1.02,11.04,9]pentadeca-1(14),2,4,6,8,10,12-heptaene (PubChem CID 142172700) has the molecular formula C15H10 and a molecular weight of 190.24 g/mol. Its IUPAC name is tetracyclo[10.2.1.02,11.04,9]pentadeca-1(14),2,4,6,8,10,12-heptaene.
| Compound Name | tetracyclo[10.2.1.02,11.04,9]pentadeca-1(14),2,4,6,8,10,12-heptaene |
|---|---|
| PubChem CID | 142172700 |
| Molecular Formula | C15H10 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | tetracyclo[10.2.1.02,11.04,9]pentadeca-1(14),2,4,6,8,10,12-heptaene |
| SMILES | C1=C2CC(=C1)c1cc3ccccc3cc12 |
| InChI | InChI=1S/C15H10/c1-2-4-11-9-15-13-6-5-12(7-13)14(15)8-10(11)3-1/h1-6,8-9H,7H2 |
| InChIKey | CSVFUTMOKMBHLI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |