C19H24 — CID 91140951
1,3-dimethylidenecyclopenta[b]naphthalene;ethane (PubChem CID 91140951) has the molecular formula C19H24 and a molecular weight of 252.40 g/mol. Its IUPAC name is 1,3-dimethylidenecyclopenta[b]naphthalene;ethane.
| Compound Name | 1,3-dimethylidenecyclopenta[b]naphthalene;ethane |
|---|---|
| PubChem CID | 91140951 |
| Molecular Formula | C19H24 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | 1,3-dimethylidenecyclopenta[b]naphthalene;ethane |
| SMILES | C=C1CC(=C)c2cc3ccccc3cc21.CC.CC |
| InChI | InChI=1S/C15H12.2C2H6/c1-10-7-11(2)15-9-13-6-4-3-5-12(13)8-14(10)15;2*1-2/h3-6,8-9H,1-2,7H2;2*1-2H3 |
| InChIKey | HPJXIXSBGDGWEB-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |