About 1-(4-methylphenyl)ethanone;molecular hydrogen;prop-2-yn-1-amine
1-(4-methylphenyl)ethanone;molecular hydrogen;prop-2-yn-1-amine (PubChem CID 142174949) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is 1-(4-methylphenyl)ethanone;molecular hydrogen;prop-2-yn-1-amine.
Molecular Properties
| Compound Name | 1-(4-methylphenyl)ethanone;molecular hydrogen;prop-2-yn-1-amine |
| PubChem CID | 142174949 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 1-(4-methylphenyl)ethanone;molecular hydrogen;prop-2-yn-1-amine |
| SMILES | C#CCN.CC(=O)c1ccc(C)cc1.[H][H] |
| InChI | InChI=1S/C9H10O.C3H5N.H2/c1-7-3-5-9(6-4-7)8(2)10;1-2-3-4;/h3-6H,1-2H3;1H,3-4H2;1H |
| InChIKey | UYOPJQNCBOLZDH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-methylphenyl)ethanone;molecular hydrogen;prop-2-yn-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methylphenyl)ethanone;molecular hydrogen;prop-2-yn-1-amine?
The IUPAC name of 1-(4-methylphenyl)ethanone;molecular hydrogen;prop-2-yn-1-amine (CID 142174949) is 1-(4-methylphenyl)ethanone;molecular hydrogen;prop-2-yn-1-amine.
What is the SMILES notation for 1-(4-methylphenyl)ethanone;molecular hydrogen;prop-2-yn-1-amine?
The canonical SMILES for 1-(4-methylphenyl)ethanone;molecular hydrogen;prop-2-yn-1-amine is C#CCN.CC(=O)c1ccc(C)cc1.[H][H].
What is the InChIKey of 1-(4-methylphenyl)ethanone;molecular hydrogen;prop-2-yn-1-amine?
The InChIKey is UYOPJQNCBOLZDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O.C3H5N.H2/c1-7-3-5-9(6-4-7)8(2)10;1-2-3-4;/h3-6H,1-2H3;1H,3-4H2;1H.
What are the key properties of 1-(4-methylphenyl)ethanone;molecular hydrogen;prop-2-yn-1-amine?
1-(4-methylphenyl)ethanone;molecular hydrogen;prop-2-yn-1-amine has a molecular weight of 191.27 g/mol, XLogP of 2.02, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methylphenyl)ethanone;molecular hydrogen;prop-2-yn-1-amine is sourced from PubChem (CID 142174949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).