C17H19BrFN — CID 142175464
5-(4-bromophenyl)-2-[(2Z,4E)-1-fluorohepta-2,4-dien-4-yl]-3,4-dihydro-2H-pyrrole (PubChem CID 142175464) has the molecular formula C17H19BrFN and a molecular weight of 336.25 g/mol. Its IUPAC name is 5-(4-bromophenyl)-2-[(2Z,4E)-1-fluorohepta-2,4-dien-4-yl]-3,4-dihydro-2H-pyrrole.
| Compound Name | 5-(4-bromophenyl)-2-[(2Z,4E)-1-fluorohepta-2,4-dien-4-yl]-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 142175464 |
| Molecular Formula | C17H19BrFN |
| Molecular Weight | 336.25 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 5-(4-bromophenyl)-2-[(2Z,4E)-1-fluorohepta-2,4-dien-4-yl]-3,4-dihydro-2H-pyrrole |
| SMILES | CC/C=C(\C=C/CF)C1CCC(c2ccc(Br)cc2)=N1 |
| InChI | InChI=1S/C17H19BrFN/c1-2-4-13(5-3-12-19)16-10-11-17(20-16)14-6-8-15(18)9-7-14/h3-9,16H,2,10-12H2,1H3/b5-3-,13-4+ |
| InChIKey | TVZLDZCYDKCZNY-OHOMROLUSA-N |
| XLogP | 5.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.25 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|