C23H32N2O3 — CID 142177017
benzyl 4-[[[(2E)-2-ethenylpenta-2,4-dienoyl]amino]methyl]piperidine-1-carboxylate;ethane (PubChem CID 142177017) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is benzyl 4-[[[(2E)-2-ethenylpenta-2,4-dienoyl]amino]methyl]piperidine-1-carboxylate;ethane.
| Compound Name | benzyl 4-[[[(2E)-2-ethenylpenta-2,4-dienoyl]amino]methyl]piperidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 142177017 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | benzyl 4-[[[(2E)-2-ethenylpenta-2,4-dienoyl]amino]methyl]piperidine-1-carboxylate;ethane |
| SMILES | C=C/C=C(\C=C)C(=O)NCC1CCN(C(=O)OCc2ccccc2)CC1.CC |
| InChI | InChI=1S/C21H26N2O3.C2H6/c1-3-8-19(4-2)20(24)22-15-17-11-13-23(14-12-17)21(25)26-16-18-9-6-5-7-10-18;1-2/h3-10,17H,1-2,11-16H2,(H,22,24);1-2H3/b19-8+; |
| InChIKey | BUBDIVMAJCXWDT-BTSUEJIHSA-N |
| XLogP | 4.48 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|