C28H45N3O3 — CID 142263872
benzyl 3-[[(2E,4E)-5-(4-aminopiperidin-1-yl)-2-ethenylhepta-2,4-dienoyl]amino]propanoate;ethane (PubChem CID 142263872) has the molecular formula C28H45N3O3 and a molecular weight of 471.69 g/mol. Its IUPAC name is benzyl 3-[[(2E,4E)-5-(4-aminopiperidin-1-yl)-2-ethenylhepta-2,4-dienoyl]amino]propanoate;ethane.
| Compound Name | benzyl 3-[[(2E,4E)-5-(4-aminopiperidin-1-yl)-2-ethenylhepta-2,4-dienoyl]amino]propanoate;ethane |
|---|---|
| PubChem CID | 142263872 |
| Molecular Formula | C28H45N3O3 |
| Molecular Weight | 471.69 g/mol |
| Exact Mass | 471.35 |
| IUPAC Name | benzyl 3-[[(2E,4E)-5-(4-aminopiperidin-1-yl)-2-ethenylhepta-2,4-dienoyl]amino]propanoate;ethane |
| SMILES | C=C/C(=C\C=C(/CC)N1CCC(N)CC1)C(=O)NCCC(=O)OCc1ccccc1.CC.CC |
| InChI | InChI=1S/C24H33N3O3.2C2H6/c1-3-20(10-11-22(4-2)27-16-13-21(25)14-17-27)24(29)26-15-12-23(28)30-18-19-8-6-5-7-9-19;2*1-2/h3,5-11,21H,1,4,12-18,25H2,2H3,(H,26,29);2*1-2H3/b20-10+,22-11+;; |
| InChIKey | SLKRLXDQYCMXIK-IMQQDABHSA-N |
| XLogP | 5.12 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.69 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|