C22H23NO4S — CID 86750582
benzyl 3-[[(E)-2-(acetylsulfanylmethyl)-3-phenylprop-2-enoyl]amino]propanoate (PubChem CID 86750582) has the molecular formula C22H23NO4S and a molecular weight of 397.50 g/mol. Its IUPAC name is benzyl 3-[[(E)-2-(acetylsulfanylmethyl)-3-phenylprop-2-enoyl]amino]propanoate.
| Compound Name | benzyl 3-[[(E)-2-(acetylsulfanylmethyl)-3-phenylprop-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 86750582 |
| Molecular Formula | C22H23NO4S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | benzyl 3-[[(E)-2-(acetylsulfanylmethyl)-3-phenylprop-2-enoyl]amino]propanoate |
| SMILES | CC(=O)SC/C(=C/c1ccccc1)C(=O)NCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H23NO4S/c1-17(24)28-16-20(14-18-8-4-2-5-9-18)22(26)23-13-12-21(25)27-15-19-10-6-3-7-11-19/h2-11,14H,12-13,15-16H2,1H3,(H,23,26)/b20-14- |
| InChIKey | UVDBRMMXAFYZGT-ZHZULCJRSA-N |
| XLogP | 3.60 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|