C17H27N5O4 — CID 142180199
N,N-dimethylmethanamine;6-[[2-(ethylamino)-3,4-dioxocyclobuten-1-yl]amino]-5-hydroxypyrimidine-4-carbaldehyde;propane (PubChem CID 142180199) has the molecular formula C17H27N5O4 and a molecular weight of 365.43 g/mol. Its IUPAC name is N,N-dimethylmethanamine;6-[[2-(ethylamino)-3,4-dioxocyclobuten-1-yl]amino]-5-hydroxypyrimidine-4-carbaldehyde;propane.
| Compound Name | N,N-dimethylmethanamine;6-[[2-(ethylamino)-3,4-dioxocyclobuten-1-yl]amino]-5-hydroxypyrimidine-4-carbaldehyde;propane |
|---|---|
| PubChem CID | 142180199 |
| Molecular Formula | C17H27N5O4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | N,N-dimethylmethanamine;6-[[2-(ethylamino)-3,4-dioxocyclobuten-1-yl]amino]-5-hydroxypyrimidine-4-carbaldehyde;propane |
| SMILES | CCC.CCNc1c(Nc2ncnc(C=O)c2O)c(=O)c1=O.CN(C)C |
| InChI | InChI=1S/C11H10N4O4.C3H9N.C3H8/c1-2-12-6-7(10(19)9(6)18)15-11-8(17)5(3-16)13-4-14-11;1-4(2)3;1-3-2/h3-4,12,17H,2H2,1H3,(H,13,14,15);1-3H3;3H2,1-2H3 |
| InChIKey | KHHZPYNGABQKIW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 124.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|