C16H21N5OS — CID 143487867
N'-[4-(ethylamino)-6-formylthieno[2,3-d]pyrimidin-5-yl]-N-methyl-N-[(E)-pent-2-en-2-yl]methanimidamide (PubChem CID 143487867) has the molecular formula C16H21N5OS and a molecular weight of 331.45 g/mol. Its IUPAC name is N'-[4-(ethylamino)-6-formylthieno[2,3-d]pyrimidin-5-yl]-N-methyl-N-[(E)-pent-2-en-2-yl]methanimidamide.
| Compound Name | N'-[4-(ethylamino)-6-formylthieno[2,3-d]pyrimidin-5-yl]-N-methyl-N-[(E)-pent-2-en-2-yl]methanimidamide |
|---|---|
| PubChem CID | 143487867 |
| Molecular Formula | C16H21N5OS |
| Molecular Weight | 331.45 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | N'-[4-(ethylamino)-6-formylthieno[2,3-d]pyrimidin-5-yl]-N-methyl-N-[(E)-pent-2-en-2-yl]methanimidamide |
| SMILES | CC/C=C(\C)N(C)/C=N/c1c(C=O)sc2ncnc(NCC)c12 |
| InChI | InChI=1S/C16H21N5OS/c1-5-7-11(3)21(4)10-20-14-12(8-22)23-16-13(14)15(17-6-2)18-9-19-16/h7-10H,5-6H2,1-4H3,(H,17,18,19)/b11-7+,20-10+ |
| InChIKey | GXLSIWGNRCBRLM-NMLBHNJLSA-N |
| XLogP | 3.84 |
| TPSA | 70.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|