C14H15N5OS — CID 143160375
N'-[(1E)-buta-1,3-dienyl]-N-[4-(ethylamino)-6-formylthieno[2,3-d]pyrimidin-5-yl]methanimidamide (PubChem CID 143160375) has the molecular formula C14H15N5OS and a molecular weight of 301.38 g/mol. Its IUPAC name is N'-[(1E)-buta-1,3-dienyl]-N-[4-(ethylamino)-6-formylthieno[2,3-d]pyrimidin-5-yl]methanimidamide.
| Compound Name | N'-[(1E)-buta-1,3-dienyl]-N-[4-(ethylamino)-6-formylthieno[2,3-d]pyrimidin-5-yl]methanimidamide |
|---|---|
| PubChem CID | 143160375 |
| Molecular Formula | C14H15N5OS |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | N'-[(1E)-buta-1,3-dienyl]-N-[4-(ethylamino)-6-formylthieno[2,3-d]pyrimidin-5-yl]methanimidamide |
| SMILES | C=C/C=C/N=C/Nc1c(C=O)sc2ncnc(NCC)c12 |
| InChI | InChI=1S/C14H15N5OS/c1-3-5-6-15-8-17-12-10(7-20)21-14-11(12)13(16-4-2)18-9-19-14/h3,5-9H,1,4H2,2H3,(H,15,17)(H,16,18,19)/b6-5+ |
| InChIKey | FNJUJDONVDPIAO-AATRIKPKSA-N |
| XLogP | 3.08 |
| TPSA | 79.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|