C19H25N5OS2 — CID 143159809
N-[4-(dimethylamino)-6-formylthieno[2,3-d]pyrimidin-5-yl]-N'-[(1E,3E)-4-methylsulfanylhexa-1,3,5-trienyl]methanimidamide;ethane (PubChem CID 143159809) has the molecular formula C19H25N5OS2 and a molecular weight of 403.58 g/mol. Its IUPAC name is N-[4-(dimethylamino)-6-formylthieno[2,3-d]pyrimidin-5-yl]-N'-[(1E,3E)-4-methylsulfanylhexa-1,3,5-trienyl]methanimidamide;ethane.
| Compound Name | N-[4-(dimethylamino)-6-formylthieno[2,3-d]pyrimidin-5-yl]-N'-[(1E,3E)-4-methylsulfanylhexa-1,3,5-trienyl]methanimidamide;ethane |
|---|---|
| PubChem CID | 143159809 |
| Molecular Formula | C19H25N5OS2 |
| Molecular Weight | 403.58 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | N-[4-(dimethylamino)-6-formylthieno[2,3-d]pyrimidin-5-yl]-N'-[(1E,3E)-4-methylsulfanylhexa-1,3,5-trienyl]methanimidamide;ethane |
| SMILES | C=C/C(=C\C=C\N=C\Nc1c(C=O)sc2ncnc(N(C)C)c12)SC.CC |
| InChI | InChI=1S/C17H19N5OS2.C2H6/c1-5-12(24-4)7-6-8-18-10-19-15-13(9-23)25-17-14(15)16(22(2)3)20-11-21-17;1-2/h5-11H,1H2,2-4H3,(H,18,19);1-2H3/b8-6+,12-7+; |
| InChIKey | CKMNPHFKSBWZCH-FSNKCASMSA-N |
| XLogP | 4.98 |
| TPSA | 70.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.58 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|