C20H27N5O3S — CID 143487420
ethane;N'-[6-formyl-4-(2-hydroxyethylamino)thieno[2,3-d]pyrimidin-5-yl]-N-[(2E,4E)-5-methoxyhepta-2,4,6-trien-2-yl]methanimidamide (PubChem CID 143487420) has the molecular formula C20H27N5O3S and a molecular weight of 417.54 g/mol. Its IUPAC name is ethane;N'-[6-formyl-4-(2-hydroxyethylamino)thieno[2,3-d]pyrimidin-5-yl]-N-[(2E,4E)-5-methoxyhepta-2,4,6-trien-2-yl]methanimidamide.
| Compound Name | ethane;N'-[6-formyl-4-(2-hydroxyethylamino)thieno[2,3-d]pyrimidin-5-yl]-N-[(2E,4E)-5-methoxyhepta-2,4,6-trien-2-yl]methanimidamide |
|---|---|
| PubChem CID | 143487420 |
| Molecular Formula | C20H27N5O3S |
| Molecular Weight | 417.54 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | ethane;N'-[6-formyl-4-(2-hydroxyethylamino)thieno[2,3-d]pyrimidin-5-yl]-N-[(2E,4E)-5-methoxyhepta-2,4,6-trien-2-yl]methanimidamide |
| SMILES | C=C/C(=C\C=C(/C)N/C=N/c1c(C=O)sc2ncnc(NCCO)c12)OC.CC |
| InChI | InChI=1S/C18H21N5O3S.C2H6/c1-4-13(26-3)6-5-12(2)20-10-21-16-14(9-25)27-18-15(16)17(19-7-8-24)22-11-23-18;1-2/h4-6,9-11,24H,1,7-8H2,2-3H3,(H,20,21)(H,19,22,23);1-2H3/b12-5+,13-6+; |
| InChIKey | IGJDWEPACZHTSU-KSQBZTCJSA-N |
| XLogP | 3.80 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|