C47H49N4+ — CID 142180945
(3E)-1,2-dimethyl-3-[(2E)-1,5,5-tris(1,2-dimethylindol-3-yl)penta-2,4-dienylidene]indol-1-ium;ethane (PubChem CID 142180945) has the molecular formula C47H49N4+ and a molecular weight of 669.94 g/mol. Its IUPAC name is (3E)-1,2-dimethyl-3-[(2E)-1,5,5-tris(1,2-dimethylindol-3-yl)penta-2,4-dienylidene]indol-1-ium;ethane.
| Compound Name | (3E)-1,2-dimethyl-3-[(2E)-1,5,5-tris(1,2-dimethylindol-3-yl)penta-2,4-dienylidene]indol-1-ium;ethane |
|---|---|
| PubChem CID | 142180945 |
| Molecular Formula | C47H49N4+ |
| Molecular Weight | 669.94 g/mol |
| Exact Mass | 669.40 |
| IUPAC Name | (3E)-1,2-dimethyl-3-[(2E)-1,5,5-tris(1,2-dimethylindol-3-yl)penta-2,4-dienylidene]indol-1-ium;ethane |
| SMILES | CC.CC1=[N+](C)c2ccccc2/C1=C(/C=C/C=C(c1c(C)n(C)c2ccccc12)c1c(C)n(C)c2ccccc12)c1c(C)n(C)c2ccccc12 |
| InChI | InChI=1S/C45H43N4.C2H6/c1-28-42(32-18-9-13-24-38(32)46(28)5)36(43-29(2)47(6)39-25-14-10-19-33(39)43)22-17-23-37(44-30(3)48(7)40-26-15-11-20-34(40)44)45-31(4)49(8)41-27-16-12-21-35(41)45;1-2/h9-27H,1-8H3;1-2H3/q+1; |
| InChIKey | FRKMIYGPXJXUIU-UHFFFAOYSA-N |
| XLogP | 11.46 |
| TPSA | 17.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.94 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|